Identifikatoren & physikalische Daten
| CAS No. | 62-83-9 |
|---|
| Summenformel | C19H28O3 |
|---|
| Durchschnittliche Molmasse | 304,4 g/mol |
|---|
| SMILES | C[C@]12CC[C@H]3[C@@H]([C@H](O)CC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2O |
|---|
| InChIKey | RNCGWYKXAJCOLD-JUKXBMAYSA-N |
|---|
| PubChem CID | 65541 |
|---|
| ChEBI | CHEBI:2295 |
|---|
| EC No. | 103-015-1 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,2 |
|---|
| Polarare Oberfläche (TPSA) | 57,5 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 0 |
|---|
| Schwere Atome | 22 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 539 |
|---|
| Lipide | Lipids -> Sterol Lipids [ST] -> Steroids [ST02] -> C19 steroids (androgens) and derivatives [ST0202] |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH351 (100%): Suspected of causing cancer [Warning Carcinogenicity]P203, P280, P318, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Carc. 2 (100%) |
|---|
