HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3,5-Dimethyl-1-(3-nitrophenyl)-1H-pyrazole-4-carboxylic acid ethyl ester
Phosphodiesterase 4 Inhibitor · Ethyl 3,5-dimethyl-1-(3-nitrophenyl)-1h-pyrazole-4-carboxylate · 3,5-Dimethyl-1-(3-nitrophenyl)-1H-pyrazole-4-carboxylic acid ethyl ester · 1H-Pyrazole-4-carboxylic acid, 3,5-dimethyl-1-(3-nitrophenyl)-, ethyl ester
Identifikatoren & physikalische Daten
| CAS No. | 346440-86-6 |
|---|---|
| Summenformel | C14H15N3O4 |
| Durchschnittliche Molmasse | 289,29 g/mol |
| Monoisotopische Masse | 289,10625596 g/mol |
| SMILES | CCOC(=O)c1c(C)nn(-c2cccc([N+](=O)[O-])c2)c1C |
| InChIKey | MSYGAHOHLUJIKV-UHFFFAOYSA-N |
| PubChem CID | 656969 |
| ChEMBL | CHEMBL1230564 |
| DTXSID | DTXSID70349675 |
Chemische & physikalische Eigenschaften
| XLogP | 2,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 89,9 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 398 |
| Arzneimittel | Pharmaceuticals -> Listed in ZINC15 |
| Lagerbedingungen | Store at -20°C |
| Löslichkeit | DMF: 30 mg/mlDMSO: 30 mg/mlDMSO:PBS (pH 7.2) (1:10): 0.1 mg/mlEthanol: 5 mg/ml |
| Aggregatzustand | Solid |
Anwendungen & Verwendung
Verwenden
Pyrazole compound with a high-affinity active site binding inhibitor of phosphodiesterases IVB and IVD