HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1,4-Divinylbenzol
PARA-DIVINYLBENZENE · JACS-105-06-6 · 4-Vinylstyrene · p-vinylstyrene · paradienebenzene · 1,4-Divinylbenzol · 1,4-diethenylbenzene · 1,4-diethenyl-benzen
Identifikatoren & physikalische Daten
| CAS No. | 105-06-6 |
|---|---|
| Summenformel | C10H10 |
| Durchschnittliche Molmasse | 130,19 g/mol |
| Monoisotopische Masse | 130,07825032 g/mol |
| SMILES | C=Cc1ccc(C=C)cc1 |
| InChIKey | WEERVPDNCOGWJF-UHFFFAOYSA-N |
| PubChem CID | 66041 |
| ChEMBL | CHEMBL1520722 |
| EC No. | 203-266-8 |
| DTXSID | DTXSID2033863 |
| Lokaler Name | 1,4-Divinylbenzol |
Chemische & physikalische Eigenschaften
| XLogP | 3,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 100 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| LogP (Verteilungskoeffizient) | 3.2 |
| Schmelzpunkt | 31°C |
| Siedepunkt | 175.9°C (rough estimate) |
| Dichte | 0.914 g/mL at 25 °C (lit.) |
| Dampfdruck | 71.06Pa at 25℃ |
| Brechungsindex | n20/D 1.5470(lit.) |
| Flammpunkt | 148 °F |
| Lagerbedingungen | -70°C |
| Aggregatzustand | low melting solid |
| Farbe | Clear, colourless |
| Löslichkeit | 1μg/L |
| InChI | InChI=1S/C10H10/c1-3-9-5-7-10(4-2)8-6-9/h3-8H,1-2H2 |
| InChIKey | WEERVPDNCOGWJF-UHFFFAOYSA-N |
| SMILES | C1(C=C)=CC=C(C=C)C=C1 |
| LogP (Verteilungskoeffizient) | 4.46 at 25℃ |
| CAS Datenbank | 105-06-6 |
| EPA chemische Informationen | p-Divinylbenzene (105-06-6) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (84.3%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P264, P264+P265, P270, P271, P272, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P333+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 51 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies.H304: May be fatal if swallowed and enters airways [Danger Aspiration hazard] |
|---|---|
| Regulatorische Informationen | Status: Active Update: 27-05-2018 https://echa.europa.eu/registration-dossier/-/registered-dossier/17357 |
| Hazard Classes and Categories | Acute Tox. 4 (84.3%)Skin corrosion/irritation - Category 2 |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | NA 1993 / PGIII |
| Zollcode | 2902900000 |
| R-Sätze (R) | 22-36/37/38-43 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 7-23-26-36-45-36/37 |
| Lagerklasse | 10 - Combustible liquids |
| Gefahrenklasse | Acute Tox. 4 OralAquatic Chronic 2Eye Irrit. 2Skin Irrit. 2 |
Anwendungen & Verwendung
Verwenden
DVB can be cross-linked with styrene/vinylbenzene chloride and incorporated with multi-walled carbon nanotubes (MWCNTs) to form new microporous nanocomposites for water remediation. It can also be used in combination with polyethylene glycol diacrylate to form linkages with polyethylene oxide (PEO), which can be used as an electrolytic material for lithium batteries.