HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 66473Erstellt: 27. Oktober 2026
1,3,6,8-Tetrachlorpyren
NSC 93972 · Pyrene, 1,3,6,8-tetrachloro-
https://huagongshe.com/de/chemical/66473
Identifikatoren & physikalische Daten
| CAS No. | 81-29-8 |
|---|
| Summenformel | C16H6Cl4 |
|---|
| Durchschnittliche Molmasse | 340 g/mol |
|---|
| Monoisotopische Masse | 337,92236091 g/mol |
|---|
| SMILES | Clc1cc(Cl)c2ccc3c(Cl)cc(Cl)c4ccc1c2c43 |
|---|
| InChIKey | KNMMEDCCXYQFAX-UHFFFAOYSA-N |
|---|
| PubChem CID | 66473 |
|---|
| EC No. | 201-340-4 |
|---|
| DTXSID | DTXSID30230838 |
|---|
| Lokaler Name | 1,3,6,8-Tetrachlorpyren |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 7,5 |
|---|
| Polarare Oberfläche (TPSA) | 0 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 0 |
|---|
| Frei drehbare Bindungen | 0 |
|---|
| Schwere Atome | 20 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 319 |
|---|
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
|---|
| Schmelzpunkt | 368 °C |
|---|
| Siedepunkt | 487.6±40.0 °C(Predicted) |
|---|
| Dichte | 1.620±0.06 g/cm3(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P273, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
