HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Diethyl 1,5-dimethyl-3-phenyl-1H-pyrrole-2,4-dicarboxylate
Diethyl 1,5-Dimethyl-3-phenylpyrrole-2,4-dicarboxylate · Diethyl 1,5-diMethyl-3-phenyl-1H-pyrrole-2,4-dicarboxylate · 1H-Pyrrole-2,4-dicarboxylic acid, 1,5-dimethyl-3-phenyl-, 2,4-diethyl ester
Identifikatoren & physikalische Daten
| CAS No. | 161560-98-1 |
|---|---|
| Summenformel | C18H21NO4 |
| Durchschnittliche Molmasse | 315,4 g/mol |
| Monoisotopische Masse | 315,14705815 g/mol |
| SMILES | CCOC(=O)c1c(-c2ccccc2)c(C(=O)OCC)n(C)c1C |
| InChIKey | JMOUFFUEOMOHGD-UHFFFAOYSA-N |
| PubChem CID | 66570713 |
| DTXSID | DTXSID20735307 |
Chemische & physikalische Eigenschaften
| XLogP | 3,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 57,5 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 7 |
| Schwere Atome | 23 |
| Formalladung | 0 |
| Komplexität | 419 |
| Siedepunkt | 466.3±45.0 °C(Predicted) |
| Dichte | 1.12±0.1 g/cm3(Predicted) |
| pKa (Säurekonstante) | -9.10±0.70(Predicted) |
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
Anwendungen & Verwendung
Verwenden
Diethyl 1,5-Dimethyl-3-phenylpyrrole-2,4-dicarboxylate is a reagent used in the preparation of antifungal agents.