HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3-Chlorophthalic anhydride
Ktoyupd · 3-CHLOROPHTHALIC · 3-CHLOROPHTHALIC ANHYDRIDE · 3 -Chlorophthalic anhydrid · 3-CHLOROPHTHALIC ANHYDRIDE 98% · 3-CHLOROPHTHALIC ACID ANHYDRIDE · 4-Chloro-1,3-isobenzofurandione · 4-chloro-2-benzofuran-1,3-dione
Identifikatoren & physikalische Daten
| CAS No. | 117-21-5 |
|---|---|
| Summenformel | C8H3ClO3 |
| Durchschnittliche Molmasse | 182,56 g/mol |
| Monoisotopische Masse | 181,97707164 g/mol |
| SMILES | O=C1OC(=O)c2c(Cl)cccc21 |
| InChIKey | UERPUZBSSSAZJE-UHFFFAOYSA-N |
| PubChem CID | 67014 |
| EC No. | 204-179-8 |
| DTXSID | DTXSID10151653 |
Chemische & physikalische Eigenschaften
| XLogP | 1,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 43,4 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 238 |
| SpringerMaterials Properties | Chemical shift |
| Schmelzpunkt | 123-126 °C |
| Siedepunkt | 170°C(lit.) |
| Dichte | 1.594±0.06 g/cm3(Predicted) |
| Dampfdruck | 0.02-0.08Pa at 25℃ |
| Lagerbedingungen | Inert atmosphere,Room Temperature |
| Aggregatzustand | Crystalline Powder and Chunks |
| Farbe | White or pale yellow |
| InChI | InChI=1S/C8H3ClO3/c9-5-3-1-2-4-6(5)8(11)12-7(4)10/h1-3H |
| InChIKey | UERPUZBSSSAZJE-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C(Cl)=CC=C2)C(=O)O1 |
| LogP (Verteilungskoeffizient) | 2.713 |
| CAS Datenbank | 117-21-5(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (14.3%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P316, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 7 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | Regulation (EC) No 1935/2004 (amended)PMN - indicates a commenced PMN (Pre-Manufacture Notices) substance.Status: Cease Manufacture Update: 18-05-2017 https://echa.europa.eu/registration-dossier/-/registered-dossier/11567 |
| Hazard Classes and Categories | Acute Tox. 3 (14.3%) |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29173995 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 37/39-26 |
Anwendungen & Verwendung
Verwenden
3-chlorophthalic anhydride is mainly used for the synthesis of polyimide engineering plastic properties. Also be used as drug or pesticide intermediates.