HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,4-dimethoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide
2,4-dimethoxy-N-(5-methyl-3-isoxazolyl)benzamide · Benzamide, 2,4-dimethoxy-N-(5-methyl-3-isoxazolyl)-
Identifikatoren & physikalische Daten
| CAS No. | 349617-25-0 |
|---|---|
| Summenformel | C13H14N2O4 |
| Durchschnittliche Molmasse | 262,26 g/mol |
| Monoisotopische Masse | 262,09535693 g/mol |
| SMILES | COc1ccc(C(=O)Nc2cc(C)on2)c(OC)c1 |
| InChIKey | MYKFBKYCDBCZGA-UHFFFAOYSA-N |
| PubChem CID | 670331 |
| ChEMBL | CHEMBL1490328 |
| DTXSID | DTXSID301321915 |
Chemische & physikalische Eigenschaften
| XLogP | 1,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 73,6 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 19 |
| Formalladung | 0 |
| Komplexität | 313 |
| Löslichkeit | 21.4 [ug/mL] (The mean of the results at pH 7.4) |
| Siedepunkt | 375.2±42.0 °C(Predicted) |
| Dichte | 1.257±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | 11.54±0.70(Predicted) |