Identifikatoren & physikalische Daten
| CAS No. | 349618-67-3 |
|---|
| Summenformel | C17H17NO3 |
|---|
| Durchschnittliche Molmasse | 283,32 g/mol |
|---|
| Monoisotopische Masse | 283,1208434 g/mol |
|---|
| SMILES | Cc1ccc(C(=O)NCc2ccc3c(c2)OCO3)cc1C |
|---|
| InChIKey | FXWNJDJTPFUZHO-UHFFFAOYSA-N |
|---|
| PubChem CID | 670710 |
|---|
| ChEMBL | CHEMBL1365174 |
|---|
| DTXSID | DTXSID201322427 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,2 |
|---|
| Polarare Oberfläche (TPSA) | 47,6 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 21 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 373 |
|---|
| Löslichkeit | 31.7 [ug/mL] (The mean of the results at pH 7.4) |
|---|
