HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-Nitro-α,α,α-trifluor-o-toluidin
4-NITRO-2-(TRIFLUOROMETHYL)ANILINE · 2-Amino-5-nitro · 4-Nitro-2-(trifL · 4-Nitro-2-(trifluoro · 5-Aminobenzotrifluoride · 5-NITRO-2-AMINOBENZOTRIFLUORIDE · 2-AMINO-5-NITROBENZOTRIFLUORIDE · 4-Nitro-2-Trifluoromethylanilin
Identifikatoren & physikalische Daten
| CAS No. | 121-01-7 |
|---|---|
| Summenformel | C7H5F3N2O2 |
| Durchschnittliche Molmasse | 206,12 g/mol |
| Monoisotopische Masse | 206,03031189 g/mol |
| SMILES | Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChIKey | HOTZLWVITTVZGY-UHFFFAOYSA-N |
| PubChem CID | 67128 |
| EC No. | 204-443-2 |
| DTXSID | DTXSID50153095 |
| Lokaler Name | 4-Nitro-α,α,α-trifluor-o-toluidin |
Chemische & physikalische Eigenschaften
| XLogP | 2 |
|---|---|
| Polarare Oberfläche (TPSA) | 71,8 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 226 |
| Schmelzpunkt | 90-92 °C(lit.) |
| Siedepunkt | 298.0±35.0 °C(Predicted) |
| Dichte | 1.4711 (estimate) |
| Lagerbedingungen | Keep in dark place,Inert atmosphere,Room temperature |
| pKa (Säurekonstante) | -1.92±0.36(Predicted) |
| Aggregatzustand | Powder |
| Farbe | Yellow to brown |
| BRN | 2121347 |
| InChI | InChI=1S/C7H5F3N2O2/c8-7(9,10)5-3-4(12(13)14)1-2-6(5)11/h1-3H,11H2 |
| InChIKey | HOTZLWVITTVZGY-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C([N+]([O-])=O)C=C1C(F)(F)F |
| CAS Datenbank | 121-01-7(CAS DataBase Reference) |
| NIST chemische Informationen | 2-Amino-5-nitrobenzotrifluoride(121-01-7) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| UN-Transportnummer | 2811 |
| Zollcode | 29214300 |
| R-Sätze (R) | 36/37/38-20/21/22 |
| Gefahrensymbole | Xi,Xn |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 26-36/37-24/25-36 |
| Gefahrenklasse | 6.1Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 Oral |
| Verpackungsgruppe | III |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Beschreibung
4-Nitro-2-(trifluoromethyl)aniline undergoes diazotization and coupling with:N-hydroxyalkylamino-5-naptholspyrazolones and naptholsulphonic acidsN-(2-cyanoethyl)-N-(hydroxyalkyl)anilines
Verwenden
4-Nitro-2-(trifluoromethyl)aniline was used in the synthesis of monoazo dyes.