HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Dimethyl(2-(methylamino)ethyl)amin
N1,N1,N2-TriMethylethane-1,2-diaMine · Trimethylethylenediamine · enediamine · N N N-TRIMETHYLETHYLENEDIAMINE · N,N,N'-Trimethylethane-1,2-diamine · N,N,N'-Trimethylethylenediamine (TMEDA) · JACS-142-25-6 · N,N,N'-TRIMETHYLETHY
Identifikatoren & physikalische Daten
| CAS No. | 142-25-6 |
|---|---|
| Summenformel | C5H14N2 |
| Durchschnittliche Molmasse | 102,18 g/mol |
| Monoisotopische Masse | 102,11569845 g/mol |
| SMILES | CNCCN(C)C |
| InChIKey | HVOYZOQVDYHUPF-UHFFFAOYSA-N |
| PubChem CID | 67338 |
| ChEMBL | CHEMBL3780444 |
| EC No. | 205-529-2 |
| DTXSID | DTXSID8059714 |
| Lokaler Name | Dimethyl(2-(methylamino)ethyl)amin |
Chemische & physikalische Eigenschaften
| XLogP | -0,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 15,3 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 7 |
| Formalladung | 0 |
| Komplexität | 35,1 |
| Schmelzpunkt | -30.89°C (estimate) |
| Siedepunkt | 116-118 °C(lit.) |
| Dichte | 0.786 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.419(lit.) |
| Flammpunkt | 49 °F |
| Lagerbedingungen | Inert atmosphere,Room Temperature |
| Aggregatzustand | Liquid |
| pKa (Säurekonstante) | 10.34±0.10(Predicted) |
| Farbe | Clear colorless |
| BRN | 505989 |
| InChI | InChI=1S/C5H14N2/c1-6-4-5-7(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | HVOYZOQVDYHUPF-UHFFFAOYSA-N |
| SMILES | C(N(C)C)CNC |
| LogP (Verteilungskoeffizient) | -0.200 |
| CAS Datenbank | 142-25-6(CAS DataBase Reference) |
| EPA chemische Informationen | 1,2-Ethanediamine, N,N,N'-trimethyl- (142-25-6) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH225 (100%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P264, P280, P301+P330+P331, P302+P361+P354, P303+P361+P353, P304+P340, P305+P354+P338, P316, P321, P363, P370+P378, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | 1,2-Ethanediamine, N,N,N'-trimethyl-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Flam. Liq. 2 (100%) |
| F | 34 |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 2733 3/PG 2 |
| Zollcode | 29212900 |
| R-Sätze (R) | 11-34-37 |
| Gefahrensymbole | F,C |
| Sicherheitshinweise (S) | 16-26-36/37/39-45 |
| Gefahrenklasse | 3Flam. Liq. 2Skin Corr. 1B |
| Verpackungsgruppe | II |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
N,N,N'-Trimethylethylenediamine is used as a precursor in the synthesis of a novel gemini surfactant viz. N,N-dimethyl-N-{2-[N'-methyl-N'-(3-sulfopropyl)-alkylammonium]ethyl}-1-alkylammonium bromides. It is also used as an amine component for in-situ formation of alpha-amino alkoxides. Further, it is involved in the synthesis of N,N'-dimethyl-N'-(2-hydroxy-aethyl)-aethylendiamin.