Identifikatoren & physikalische Daten
| CAS No. | 5575-06-4 |
|---|
| Summenformel | C17H19NO |
|---|
| Durchschnittliche Molmasse | 253,34 g/mol |
|---|
| Monoisotopische Masse | 253,14666423 g/mol |
|---|
| SMILES | Cc1ccc(C(=O)Nc2c(C)cc(C)cc2C)cc1 |
|---|
| InChIKey | FUSRYDZISXHLFH-UHFFFAOYSA-N |
|---|
| PubChem CID | 675021 |
|---|
| EC No. | 666-386-3 |
|---|
| DTXSID | DTXSID40971124 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,7 |
|---|
| Polarare Oberfläche (TPSA) | 29,1 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 1 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 19 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 294 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH400 (100%): Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard]P273, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Aquatic Acute 1 (100%) |
|---|
