HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Dimethoxymethyl(3,3,3-trifluorpropyl)silan
DIMETHOXYMETHYL(3,3,3-TRIFLUOROPROPYL)SILANE · TRIFLUOROPROPYLMETHYLDIMETHOXYSILANE · 3,3,3-Trifluorpropylmethyldimethoxysilan · 3,3,3-Trifluorpropyl Methyl Dimethoxysilane · (3,3,3-TRIFLUOROPROPYL)METHYLDIMETHOXYSILANE · METHYL(3,3,3-TRIFLUOROPROPYL)DIMETHOXYSILANE · Methyldimethoxy(3,3,3-trifluoropropyl)silane · 3,3,3-Trifluoropropyldimethoxy(methyl)silane
Identifikatoren & physikalische Daten
| CAS No. | 358-67-8 |
|---|---|
| Summenformel | C6H13F3O2Si |
| Durchschnittliche Molmasse | 202,25 g/mol |
| Monoisotopische Masse | 202,06369067 g/mol |
| SMILES | CO[Si](C)(CCC(F)(F)F)OC |
| InChIKey | DIJRHOZMLZRNLM-UHFFFAOYSA-N |
| PubChem CID | 67751 |
| EC No. | 206-619-4 |
| DTXSID | DTXSID30957179 |
| Lokaler Name | Dimethoxymethyl(3,3,3-trifluorpropyl)silan |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 18,5 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 133 |
| Schmelzpunkt | 27 °C |
| Siedepunkt | 85 °C |
| Dichte | 1.089 g/mL at 20 °C(lit.) |
| Brechungsindex | n20/D 1.358 |
| Flammpunkt | 58°C |
| Lagerbedingungen | under inert gas (nitrogen or Argon) at 2-8°C |
| Aggregatzustand | clear liquid |
| Farbe | Colorless to Almost colorless |
| Wichte | 1.095 |
| BRN | 1753237 |
| InChI | InChI=1S/C6H13F3O2Si/c1-10-5(11-2)12-4-3-6(7,8)9/h5H,3-4,12H2,1-2H3 |
| InChIKey | YEROEIVBCZSQJY-UHFFFAOYSA-N |
| SMILES | [SiH2](C(OC)OC)CCC(F)(F)F |
| CAS Datenbank | 358-67-8(CAS DataBase Reference) |
| EPA chemische Informationen | Silane, dimethoxymethyl(3,3,3-trifluoropropyl)- (358-67-8) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| F | 10-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 1993 3/PG 3 |
| Zollcode | 2931900090 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 26-36 |
| Gefahrenklasse | 3Flam. Liq. 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
3,3,3-Trifluoropropylmethyldimethoxysilane is mainly used in superhydrophobic coatings and surface treatment of inorganic fillers. It can be used in cosmetics and display or semiconductor devices production.