HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-(2,4-Difluorphenyl)ethan-1-on
1-(2,4-difluorophenyl)ethan-1-one · 2,4-DIFLUOROACETOPHENONE · 1-(2,4-DIFLUOROPHENYL)ETHANONE · 2,4-Difluoroacet · 2',4'-Difluoroacetop · Dilfuoroacetophenone · 2',4'-Difluoroacetophenone · 2,4-Difluoroacetophenone,98%
Identifikatoren & physikalische Daten
| CAS No. | 364-83-0 |
|---|---|
| Summenformel | C8H6F2O |
| Durchschnittliche Molmasse | 156,13 g/mol |
| Monoisotopische Masse | 156,03867125 g/mol |
| SMILES | CC(=O)c1ccc(F)cc1F |
| InChIKey | QEWHNJPLPZOEKU-UHFFFAOYSA-N |
| PubChem CID | 67770 |
| EC No. | 206-667-6 |
| DTXSID | DTXSID3059894 |
| Lokaler Name | 1-(2,4-Difluorphenyl)ethan-1-on |
Chemische & physikalische Eigenschaften
| XLogP | 1,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 17,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 158 |
| Siedepunkt | 80-81 °C25 mm Hg(lit.) |
| Dichte | 1.234 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.488(lit.) |
| Flammpunkt | 152 °F |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Aggregatzustand | Liquid |
| Wichte | 1.234 |
| Farbe | Clear colorless to yellow |
| Löslichkeit | INSOLUBLE |
| BRN | 1940741 |
| InChI | InChI=1S/C8H6F2O/c1-5(11)7-3-2-6(9)4-8(7)10/h2-4H,1H3 |
| InChIKey | QEWHNJPLPZOEKU-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(F)C=C1F)C |
| CAS Datenbank | 364-83-0(CAS DataBase Reference) |
| NIST chemische Informationen | Ethanone, 1-(2,4-difluorophenyl)-(364-83-0) |
| EPA chemische Informationen | Ethanone, 1-(2,4-difluorophenyl)- (364-83-0) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| F | 8 |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29147090 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36-37/39 |
| Gefahrenklasse | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
2'',4''-Difluoroacetophenone