HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1,3-Difluorpropan-2-ol
1,3-difluoro-2-propano · Geiftor · Glyfluor · Glyfluro · 1,3-DIFLUOROPROPAN-2-OL · 1,3-Difluoro-2-propanol · 1,3-DIFLUORO-ISO-PROPANOL · 2-Propanol, 1,3-difluoro-
Identifikatoren & physikalische Daten
| CAS No. | 453-13-4 |
|---|---|
| Summenformel | C3H6F2O |
| Durchschnittliche Molmasse | 96,08 g/mol |
| Monoisotopische Masse | 96,03867125 g/mol |
| SMILES | OC(CF)CF |
| InChIKey | PVDLUGWWIOGCNH-UHFFFAOYSA-N |
| PubChem CID | 67985 |
| EC No. | 207-216-6 |
| DTXSID | DTXSID1060009 |
| Lokaler Name | 1,3-Difluorpropan-2-ol |
Chemische & physikalische Eigenschaften
| XLogP | -0,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 20,2 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 6 |
| Formalladung | 0 |
| Komplexität | 28 |
| Siedepunkt | 54-55 °C34 mm Hg(lit.) |
| Dichte | 1.24 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.373(lit.) |
| Flammpunkt | 108 °F |
| Lagerbedingungen | Flammables area |
| Löslichkeit | soluble in DMSO, Methanol |
| Aggregatzustand | Liquid |
| pKa (Säurekonstante) | 12.67±0.20(Predicted) |
| Farbe | Clear yellow to brownish |
| BRN | 1732050 |
| InChI | InChI=1S/C3H6F2O/c4-1-3(6)2-5/h3,6H,1-2H2 |
| InChIKey | PVDLUGWWIOGCNH-UHFFFAOYSA-N |
| SMILES | C(F)C(O)CF |
| CAS Datenbank | 453-13-4(CAS DataBase Reference) |
| EPA chemische Informationen | 2-Propanol, 1,3-difluoro- (453-13-4) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | 2-Propanol, 1,3-difluoro-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 1987 3/PG 3 |
| Zollcode | 29055998 |
| RTECS-Nr. | UB1770000 |
| R-Sätze (R) | 10-36/37/38 |
| Gefahrensymbole | Xi,F |
| hazard_note | Flammable |
| Sicherheitshinweise (S) | 16-26-36 |
| Gefahrenklasse | 3Eye Irrit. 2Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
1,3-Difluoro-2-propanol was used in the synthesis of 1,3-difluoroacetone.