HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Methyl-8-nitro-6-chinolylether
6-METHOXY-8-NITROQUINO · Primaquine EP Impurity B · Methoxy-8-Nitroquinoline · 6-methoxy-8-nitro-quinolin · 8-Nitro-6-methoxyquinoline · 6-Methoxy-8-nitroquinoline · 6-Methoxy-8-nitroquinoline>6-METOXY-8-NITROQUINOLINE,99% · Quinoline, 6-methoxy-8-nitro-
Identifikatoren & physikalische Daten
| CAS No. | 85-81-4 |
|---|---|
| Summenformel | C10H8N2O3 |
| Durchschnittliche Molmasse | 204,18 g/mol |
| Monoisotopische Masse | 204,05349212 g/mol |
| SMILES | COc1cc([N+](=O)[O-])c2ncccc2c1 |
| InChIKey | MIMUSZHMZBJBPO-UHFFFAOYSA-N |
| PubChem CID | 6822 |
| ChEMBL | CHEMBL166980 |
| EC No. | 201-633-7 |
| DTXSID | DTXSID50234050 |
| Lokaler Name | Methyl-8-nitro-6-chinolylether |
Chemische & physikalische Eigenschaften
| XLogP | 1,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 67,9 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 241 |
| Schmelzpunkt | 158-160 °C(lit.) |
| Siedepunkt | 342.67°C (rough estimate) |
| Dichte | 1.3244 (rough estimate) |
| Brechungsindex | 1.5910 (estimate) |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| pKa (Säurekonstante) | 1.25±0.20(Predicted) |
| Aggregatzustand | Crystalline Powder |
| Farbe | Yellow |
| CAS Datenbank | 85-81-4(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29334900 |
| RTECS-Nr. | VC0365000 |
| R-Sätze (R) | 20/21/22-36/37/38-40 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 26-27-36/37/39 |
Anwendungen & Verwendung
Verwenden
6-Methoxy-8-nitroquinoline is used in treating and preventing pancreatic cancer. Also, used in preparation of Quinoline derivatives as antiparasitic agents useful in the prophylaxis and treatment of malaria and parasitic diseases.