HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3-cyclohexyl-4-[(E)-(2-fluorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione
5-CYCLOHEXYL-4-((2-FLUOROBENZYLIDENE)AMINO)-4H-1,2,4-TRIAZOLE-3-THIOL · 3-cyclohexyl-4-[(E)-(2-fluorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione · 3H-1,2,4-Triazole-3-thione, 5-cyclohexyl-4-[[(2-fluorophenyl)methylene]amino]-2,4-dihydro-
![Molekülstruktur von 3-cyclohexyl-4-[(E)-(2-fluorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione](/img/chemical/6858366.png)
Identifikatoren & physikalische Daten
| CAS No. | 489442-68-4 |
|---|---|
| Summenformel | C15H17FN4S |
| Durchschnittliche Molmasse | 304,4 g/mol |
| Monoisotopische Masse | 304,11579589 g/mol |
| SMILES | Fc1ccccc1/C=N/n1c(C2CCCCC2)n[nH]c1=S |
| InChIKey | NUBVSCDGQJXYPC-LICLKQGHSA-N |
| PubChem CID | 6858366 |
| ChEMBL | CHEMBL3192883 |
| DTXSID | DTXSID801327287 |
Chemische & physikalische Eigenschaften
| XLogP | 3,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 72,1 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 445 |
| Löslichkeit | 1.9 [ug/mL] (The mean of the results at pH 7.4) |
| Siedepunkt | 407.4±47.0 °C(Predicted) |
| Dichte | 1.35±0.1 g/cm3(Predicted) |
| pKa (Säurekonstante) | 8.99±0.20(Predicted) |