HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 6868331Erstellt: 4. November 2026
(E)-3-((2-([1,2,4]triazolo[3,4-a]phthalazin-6-yl)hydrazono)methyl)phenol
https://huagongshe.com/de/chemical/6868331
Identifikatoren & physikalische Daten
| CAS No. | 500270-15-5 |
|---|
| Summenformel | C16H12N6O |
|---|
| Durchschnittliche Molmasse | 304,31 g/mol |
|---|
| Monoisotopische Masse | 304,10725903 g/mol |
|---|
| SMILES | Oc1cccc(/C=N/Nc2nn3cnnc3c3ccccc23)c1 |
|---|
| InChIKey | WUVOBSZNHZDHIR-RQZCQDPDSA-N |
|---|
| PubChem CID | 6868331 |
|---|
| ChEMBL | CHEMBL3198235 |
|---|
| DTXSID | DTXSID201333402 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,6 |
|---|
| Polarare Oberfläche (TPSA) | 87,7 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 6 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 23 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 433 |
|---|
| Löslichkeit | 0.3 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von (E)-3-((2-([1,2,4]triazolo[3,4-a]phthalazin-6-yl)hydrazono)methyl)phenol](/img/chemical/6868331.png)