HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(2R)-1-((9H-fluoren-9-ylmethoxy)carbonyl)pyrrolidine-2-carboxylic acid
FMOC-D-PRO-OH · FMOC-D-PRO · FMOC-D- · FMOC-D-PRO-OH H2O · n-[(9h-fluoren-9-ylmethoxy)carbonyl]-d-proline · (R)-PYRROLIDINE-1,2-DICARBOXYLIC ACID 1-(9H-FLUOREN-9-YLMETHYL) ESTER · Fmoc-D-proL · FMOC-D-PROLINE
Identifikatoren & physikalische Daten
| CAS No. | 101555-62-8 |
|---|---|
| Summenformel | C20H19NO4 |
| Durchschnittliche Molmasse | 337,4 g/mol |
| Monoisotopische Masse | 337,13140809 g/mol |
| SMILES | O=C(O)[C@H]1CCCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChIKey | ZPGDWQNBZYOZTI-GOSISDBHSA-N |
| PubChem CID | 688136 |
| EC No. | 691-539-6 |
| DTXSID | DTXSID20906313 |
Chemische & physikalische Eigenschaften
| XLogP | 3,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 66,8 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 25 |
| Formalladung | 0 |
| Komplexität | 500 |
| Schmelzpunkt | 110-116°C |
| Siedepunkt | 548.6±43.0 °C(Predicted) |
| Dichte | 1.328±0.06 g/cm3(Predicted) |
| Brechungsindex | 32 ° (C=1, DMF) |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pKa (Säurekonstante) | 3.95±0.20(Predicted) |
| Aggregatzustand | powder to crystal |
| Farbe | White to Light yellow |
| BRN | 5856698 |
| Hauptanwendungen | peptide synthesis |
| InChI | InChI=1S/C20H19NO4/c22-19(23)18-10-5-11-21(18)20(24)25-12-17-15-8-3-1-6-13(15)14-7-2-4-9-16(14)17/h1-4,6-9,17-18H,5,10-12H2,(H,22,23)/t18-/m1/s1 |
| InChIKey | ZPGDWQNBZYOZTI-GOSISDBHSA-N |
| SMILES | N1(C(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)CCC[C@@H]1C(O)=O |
| CAS Datenbank | 101555-62-8(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (50%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (50%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 2933 99 80 |
| Sicherheitshinweise (S) | 22-24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
In organic synthesis, N-Fmoc-D-proline are often employed as important intermediates in various areas such as peptide synthesis, asymmetric synthesis, medicinal chemistry, and polymer chemistry.