HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Ethyldiphenylphosphine
(Diphenylphosphino)ethane · NSC 151254 · 1-(Diphenylphosphi · DIPHENYLETHYLPHOSPHINE · Ethyldiphenylphosphine · Ethyl-diphenyl-phosphane · Phosphine, ethyldiphenyl- · Ethyldiphenylphosphine >Ethyldiphenylphosphine 98%
Identifikatoren & physikalische Daten
| CAS No. | 607-01-2 |
|---|---|
| Summenformel | C14H15P |
| Durchschnittliche Molmasse | 214,24 g/mol |
| Monoisotopische Masse | 214,09113711 g/mol |
| SMILES | CCP(c1ccccc1)c1ccccc1 |
| InChIKey | WUOIAOOSKMHJOV-UHFFFAOYSA-N |
| PubChem CID | 69082 |
| EC No. | 627-386-9 |
| DTXSID | DTXSID4073207 |
Chemische & physikalische Eigenschaften
| XLogP | 3,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 148 |
| Siedepunkt | 293 °C(lit.) |
| Dichte | 1.048 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.614(lit.) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | under inert gas (nitrogen or Argon) at 2-8°C |
| Aggregatzustand | Liquid |
| Farbe | Clear colorless |
| Wichte | 1.048 |
| BRN | 744253 |
| InChI | InChI=1S/C14H15P/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
| InChIKey | WUOIAOOSKMHJOV-UHFFFAOYSA-N |
| SMILES | P(CC)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS Datenbank | 607-01-2(CAS DataBase Reference) |
| EPA chemische Informationen | Phosphine, ethyldiphenyl- (607-01-2) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| F | 10-13-23 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | 3278 |
| Zollcode | 29310099 |
| RTECS-Nr. | SY9242500 |
| R-Sätze (R) | 22-36/37/38 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 26-36 |
| Gefahrenklasse | 6.1Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
Catalyst for:Three component coupling reactions of arylaldehydes with Me vinyl ketone and phthalimideRegio- and stereoselective hydroalkynylation of methylenecyclopropanesSynthesis of oxazolidines, thiazolidines, pyrrolidines, and indolesDimer to monomer conversionTandem Morita-Baylis-Hillman/Michael addition reactionsPlatinum-catalyzed cyclizationRegioselective and stereoselective [3+2] cycloadditionPlatinum-catalyzed intermolecular hydroaminationHydroformylation reactions