HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-Chloro-3-nitrophenol
TIMTEC-BB SBB007930 · 4-CHLORO-3-NITROPHENOL · 3-NITRO-4-CHLOROPHENOL · 4-Chloro-3-nitrophenol, A · Phenol, 4-chloro-3-nitro- · 4-Chloro-3-Nitrophenol98% · 4-Chloro-3-nitrophenol >4-CHLORO-3-NITROPHENOL 98% · 2-Nitro-4-Hydroxyphenyl Chloride
Identifikatoren & physikalische Daten
| CAS No. | 610-78-6 |
|---|---|
| Summenformel | C6H4ClNO3 |
| Durchschnittliche Molmasse | 173,55 g/mol |
| Monoisotopische Masse | 172,98797067 g/mol |
| SMILES | O=[N+]([O-])c1cc(O)ccc1Cl |
| InChIKey | JUIKCULGDIZNDI-UHFFFAOYSA-N |
| PubChem CID | 69127 |
| EC No. | 612-076-8 |
| DTXSID | DTXSID90209863 |
Chemische & physikalische Eigenschaften
| XLogP | 1,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 66,1 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 158 |
| Schmelzpunkt | 125-128 °C (lit.) |
| Siedepunkt | 308.8±27.0 °C(Predicted) |
| Dichte | 1.554±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Aggregatzustand | Crystalline Powder |
| pKa (Säurekonstante) | 7.70±0.10(Predicted) |
| Farbe | brown |
| BRN | 2094546 |
| InChI | 1S/C6H4ClNO3/c7-5-2-1-4(9)3-6(5)8(10)11/h1-3,9H |
| InChIKey | JUIKCULGDIZNDI-UHFFFAOYSA-N |
| SMILES | Oc1ccc(Cl)c(c1)[N+]([O-])=O |
| CAS Datenbank | 610-78-6(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | 4-Chloro-3-nitrophenol: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | 2811 |
| Zollcode | 29089000 |
| R-Sätze (R) | 20/21/22-36/37/38-36/37/381 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 26-36-36/37/39 |
| Gefahrenklasse | 6.1Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
4-Chloro-3-nitrophenol may be used as sole carbon and energy supplement for Pseudomonas sp. JHN.