HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
cis-4-Hydroxy-L-prolin
(2S,4S)-4-HYDROXYPYRROLIDINE-2-CARBOXYLIC ACID · H-CIS-HYP-OH · CIS-4-HYDROXYPROLINE · CIS-HYP-OH · CIS-HYDROXYPROLINE · cis-Hydroxy-L-proline · (4S)-4-hydroxypyrrolidine-2-carboxylic acid · CHYP
Identifikatoren & physikalische Daten
| CAS No. | 618-27-9 |
|---|---|
| Summenformel | C5H9NO3 |
| Durchschnittliche Molmasse | 131,13 g/mol |
| SMILES | O=C(O)[C@@H]1CC(O)CN1 |
| InChIKey | PMMYEEVYMWASQN-IMJSIDKUSA-N |
| PubChem CID | 69248 |
| ChEBI | CHEBI:18240 |
| Lokaler Name | cis-4-Hydroxy-L-prolin |
Chemische & physikalische Eigenschaften
| XLogP | -3,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 69,6 |
| H-Brücken-Donoren | 3 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 125 |
| Schmelzpunkt | 257 °C (dec.) (lit.) |
| Siedepunkt | 242.42°C (rough estimate) |
| Dichte | 1.3121 (rough estimate) |
| Brechungsindex | -59 ° (C=2, H2O) |
| Lagerbedingungen | Keep in dark place,Sealed in dry,Room Temperature |
| Löslichkeit | soluble |
| Aggregatzustand | Powder |
| pKa (Säurekonstante) | 2.14±0.40(Predicted) |
| Farbe | White to beige |
| Merck | 14,4840 |
| BRN | 81440 |
| Hauptanwendungen | peptide synthesis |
| InChI | 1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4-/m0/s1 |
| InChIKey | PMMYEEVYMWASQN-IMJSIDKUSA-N |
| SMILES | O[C@@H]1CN[C@@H](C1)C(O)=O |
| CAS Datenbank | 618-27-9(CAS DataBase Reference) |
| EPA chemische Informationen | L-Proline, 4-hydroxy-, (4S)- (618-27-9) |
Sicherheit & Vorschriften
| Regulatorische Informationen | Chemical: L-Proline, 4-hydroxy-, cis- |
|---|---|
| Weitere Sicherheitsinformationen | IMAP assessments - L-Proline, 4-hydroxy-, cis-: Environment tier I assessment |
| F | 10 |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29339900 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 24/25-36/37/39-27-26 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
cis-4-Hydroxy-L-proline (CHP) is a proline analog that inhibits collagen synthesis and has been used as an anticancer compound. CHP blocked myotube formation and expression of sarcomeric myosin heavy chain in C2C12 murine skeletal muscle cells. CHP inhibited proliferation of murine Panc02 pancreatic carcinoma cell line3 and rat pancreatic carcinoma cell line DSL6A. cis-4-Hydroxy-L-proline and other hydrosyl-L-prolines are important intermediates for chiral synthesis of potential drugs.