HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(4R,5S)-(-)-1,5-Dimethyl-4-phenyl-2-imidazolidinone
(4R,5S)-(-)-1,5-DIMETHYL-4-PHENYL-2-IMIDAZOLIDINONE · 1,5-dimethyl-4-phenyl-2-imidazolidine · (4R,5S)-1,5-DIMETHYL-4-PHENYLIMIDAZOLIDINONE · (4R 5s)-1 5-dimethyl-4-phenyl-2-imidazolidone · (4R)-4α-Phenyl-1,5α-dimethylimidazolidine-2-one · (4R,5S)-1,5-Dimethyl-4-phenylimidazolidine-2-one · [4R,5S,(-)]-1,5-Dimethyl-4-phenylimidazolidin-2-one · 2-Imidazolidinone, 1,5-dimethyl-4-phenyl-, (4R,5S)-
Identifikatoren & physikalische Daten
| CAS No. | 190791-33-4 |
|---|---|
| Summenformel | C11H14N2O |
| Durchschnittliche Molmasse | 190,24 g/mol |
| Monoisotopische Masse | 190,11061307 g/mol |
| SMILES | C[C@H]1[C@@H](c2ccccc2)NC(=O)N1C |
| InChIKey | BGPAZBKCZVVZGF-WPRPVWTQSA-N |
| PubChem CID | 6931391 |
| ChEMBL | CHEMBL3189109 |
| DTXSID | DTXSID9049374 |
Chemische & physikalische Eigenschaften
| XLogP | 1,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 32,3 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 223 |
| Schmelzpunkt | 171-174 °C(lit.) |
| Siedepunkt | 335.9±17.0 °C(Predicted) |
| Dichte | 1.077±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | 13.70±0.60(Predicted) |
| Aggregatzustand | solid |
| BRN | 3607899 |
| InChI | 1S/C11H14N2O/c1-8-10(12-11(14)13(8)2)9-6-4-3-5-7-9/h3-8,10H,1-2H3,(H,12,14)/t8-,10-/m0/s1 |
| InChIKey | BGPAZBKCZVVZGF-WPRPVWTQSA-N |
| SMILES | C[C@H]1[C@H](NC(=O)N1C)c2ccccc2 |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Sicherheitshinweise (S) | 22-24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
Employed in the synthesis of optically active mono-, di-, and trihydroxy compounds.