HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Ethyl-3-chlorpropionat
Ethyl 3-chloropropanoate · DK847 · DKSI146 · DKFELEX0223 · Ethyl 3-chloropropio · ETHYL 3-CHOOROCAETATE · Ethyl 3-chloropropion · Ethyl chloropropionate
Identifikatoren & physikalische Daten
| CAS No. | 623-71-2 |
|---|---|
| Summenformel | C5H9ClO2 |
| Durchschnittliche Molmasse | 136,58 g/mol |
| Monoisotopische Masse | 136,02910721 g/mol |
| SMILES | CCOC(=O)CCCl |
| InChIKey | ZCLGVXACCAZJOX-UHFFFAOYSA-N |
| PubChem CID | 69341 |
| EC No. | 210-809-2 |
| DTXSID | DTXSID5060774 |
| Lokaler Name | Ethyl-3-chlorpropionat |
Chemische & physikalische Eigenschaften
| XLogP | 1 |
|---|---|
| Polarare Oberfläche (TPSA) | 26,3 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 8 |
| Formalladung | 0 |
| Komplexität | 72,8 |
| SpringerMaterials Properties | Boiling point |
| Siedepunkt | 162-163 °C(lit.) |
| Dichte | 1.003 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.425(lit.) |
| Flammpunkt | 130 °F |
| Lagerbedingungen | Store below +30°C. |
| Aggregatzustand | clear liquid |
| Farbe | Colorless to Almost colorless |
| Wichte | 1.00 |
| Löslichkeit | Immiscible |
| BRN | 385698 |
| Dielektrizitätskonstante | 10.1(20℃) |
| InChI | InChI=1S/C5H9ClO2/c1-2-8-5(7)3-4-6/h2-4H2,1H3 |
| InChIKey | ZCLGVXACCAZJOX-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CCCl |
| CAS Datenbank | 623-71-2(CAS DataBase Reference) |
| NIST chemische Informationen | Ethyl 3-chloropropionate(623-71-2) |
| EPA chemische Informationen | Propanoic acid, 3-chloro-, ethyl ester (623-71-2) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | Chemical: Propanoic acid, 3-chloro-, ethyl esterEthyl 3-chloropropionate: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | 3272 |
| Zollcode | 29159080 |
| R-Sätze (R) | 36/37/38-10 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36-37/39-16 |
| Gefahrenklasse | 3.2Eye Irrit. 2Flam. Liq. 3Skin Irrit. 2 |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
Ethyl β-chloropropionate, is a building block used in various chemical synthesis.