HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Ethylazidoacetat
ethyl 2-azidoacetate · azidoacetate · azido-aceticaciethylester · DDYSYZ · ETHYL AZIDOACET · ETHYLAZIDACETATE · ETHYL AZIDOACETATE · Ethyl azidacetate 97%
Identifikatoren & physikalische Daten
| CAS No. | 637-81-0 |
|---|---|
| Summenformel | C4H7N3O2 |
| Durchschnittliche Molmasse | 129,12 g/mol |
| Monoisotopische Masse | 129,05382646 g/mol |
| SMILES | CCOC(=O)CN=[N+]=[N-] |
| InChIKey | HVJJYOAPXBPQQV-UHFFFAOYSA-N |
| PubChem CID | 69480 |
| EC No. | 211-301-3 |
| DTXSID | DTXSID30213101 |
| Lokaler Name | Ethylazidoacetat |
Chemische & physikalische Eigenschaften
| XLogP | 1,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 40,7 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 139 |
| Siedepunkt | 44-46°C 2mm |
| Dichte | 1.12g/ml |
| Brechungsindex | 1.4330 to 1.4370 |
| Flammpunkt | 25 °C |
| Lagerbedingungen | Refrigerator, under inert atmosphere |
| Löslichkeit | Chloroform (Sparingly), Ethyl Acetate (Slightly) |
| Aggregatzustand | Oil |
| Farbe | Colourless to Pale Yellow |
| BRN | 4247209 |
| InChI | InChI=1S/C4H7N3O2/c1-2-9-4(8)3-6-7-5/h2-3H2,1H3 |
| InChIKey | HVJJYOAPXBPQQV-UHFFFAOYSA-N |
| SMILES | C(=O)(OCC)CN=[N+]=[N-] |
| CAS Datenbank | 637-81-0(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH226 (90.5%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 21 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (90.5%) |
| Wassergefährdungsklasse (WGK) | 2 |
| UN-Transportnummer | UN 1593 6.1/PG 3 |
| Zollcode | 2929.90.5090 |
| R-Sätze (R) | 1-40-36/37/38-10-67-65-63-48/20-38-11 |
| Gefahrensymbole | Xn,Xi,C,F |
| hazard_note | Irritant/Corrosive |
| Sicherheitshinweise (S) | 7-16-26-35-36-47-62-45-36/37 |
| Gefahrenklasse | 3Eye Irrit. 2Flam. Liq. 2 |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
Ethyl Azidoacetate is an important organic substance that can undergo cyclisation reactions and is commonly used in the field of chemical synthesis.The condensation of 1-methyl-β-carboline-3-carbaldehyde with ethyl azidoacetate can be used to prepare 2-formylxanthine derivatives[1].