Identifikatoren & physikalische Daten
| CAS No. | 675-15-0 |
|---|
| Summenformel | C8H18AlF |
|---|
| Durchschnittliche Molmasse | 160,21 g/mol |
|---|
| Monoisotopische Masse | 160,1207921 g/mol |
|---|
| SMILES | CC(C)[CH2][Al]([F])[CH2]C(C)C |
|---|
| InChIKey | SJBIACKVFNCVOM-UHFFFAOYSA-M |
|---|
| PubChem CID | 69604 |
|---|
| EC No. | 211-621-3 |
|---|
| DTXSID | DTXSID401299072 |
|---|
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 0 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 1 |
|---|
| Frei drehbare Bindungen | 4 |
|---|
| Schwere Atome | 10 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 71,3 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH250 (100%): Catches fire spontaneously if exposed to air [Danger Pyrophoric liquids]P210, P222, P223, P231, P231+P232, P233, P260, P264, P280, P301+P330+P331, P302+P335+P334, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P370+P378, P402+P404, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Pyr. Liq. 1 (100%) |
|---|
