HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Hexafluorglutaryldichlorid
Hexafluor · PERFLUOROGLUTARYL CHLORIDE · HEXAFLUOROGLUTARYL CHLORIDE · Perfluoroglutarylchloride98% · HEXAFLUOROGLUTARYL DICHLORIDE · Hexafluoroglutarylchloride98% · Glutaryl chloride, hexafluoro- · Perfluoroglutaryl chloride 98%
Identifikatoren & physikalische Daten
| CAS No. | 678-77-3 |
|---|---|
| Summenformel | C5Cl2F6O2 |
| Durchschnittliche Molmasse | 276,947 g/mol |
| Monoisotopische Masse | 275,91795392 g/mol |
| SMILES | O=C(Cl)C(F)(F)C(F)(F)C(F)(F)C(=O)Cl |
| InChIKey | QOLALWJWCONGMG-UHFFFAOYSA-N |
| PubChem CID | 69621 |
| EC No. | 211-651-7 |
| DTXSID | DTXSID0060985 |
| Lokaler Name | Hexafluorglutaryldichlorid |
Chemische & physikalische Eigenschaften
| Siedepunkt | 110-112°C |
|---|---|
| Dichte | 1.64 |
| Brechungsindex | 1.354 |
| Flammpunkt | 110-112°C |
| Aggregatzustand | liquid |
| Wichte | 1.640 |
| Farbe | Clear |
| BRN | 1914561 |
| InChI | 1S/C5Cl2F6O2/c6-1(14)3(8,9)5(12,13)4(10,11)2(7)15 |
| InChIKey | QOLALWJWCONGMG-UHFFFAOYSA-N |
| SMILES | FC(F)(C(Cl)=O)C(F)(F)C(F)(F)C(Cl)=O |
| CAS Datenbank | 678-77-3(CAS DataBase Reference) |
| EPA chemische Informationen | Pentanedioyl dichloride, hexafluoro- (678-77-3) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | WGK 3 |
|---|---|
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | 3265 |
| Zollcode | 2913000090 |
| R-Sätze (R) | 34-37-22 |
| Gefahrensymbole | C,Xn |
| hazard_note | Corrosive |
| Sicherheitshinweise (S) | 26-36/37/39 |
| Gefahrenklasse | 8Acute Tox. 4 Oral |
| Verpackungsgruppe | II |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
Hexafluoroglutaryl Chloride (CAS# 678-77-3) can be used to treat VOCs waste gas. It can also be used to prepare triptyl polymer separating membrane.