HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Benzol-1,2:4,5-tetracarbonsaeuredianhydrid
PMDA · Pyromellitic anhydride · 1,2,4,5-BENZENETETRACARBOXYLIC ANHYDRIDE · BENZENE-1,2,4,5-TETRACARBOXYLIC DIANHYDRIDE · 1,2,4,5-BENZENETETRACARBOXYLIC DIANHYDRIDE · Dicarboxylic anhydride · Pyromellitic acid dianhydride · benzenetetracarboxylic anhydride
Identifikatoren & physikalische Daten
| CAS No. | 89-32-7 |
|---|---|
| Summenformel | C10H2O6 |
| Durchschnittliche Molmasse | 218,12 g/mol |
| Monoisotopische Masse | 217,98513778 g/mol |
| SMILES | O=c1oc(=O)c2cc3c(=O)oc(=O)c3cc12 |
| InChIKey | ANSXAPJVJOKRDJ-UHFFFAOYSA-N |
| PubChem CID | 6966 |
| ChEMBL | CHEMBL3182140 |
| EC No. | 201-898-9 |
| DTXSID | DTXSID1026536 |
| Lokaler Name | Benzol-1,2:4,5-tetracarbonsaeuredianhydrid |
Chemische & physikalische Eigenschaften
| XLogP | 0,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 86,7 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 16 |
| Formalladung | 0 |
| Komplexität | 349 |
| Schmelzpunkt | 283-286 °C(lit.) |
| Siedepunkt | 397-400 °C(lit.) |
| Dichte | 1,68 g/cm3 |
| Dampfdruck | 0Pa at 25℃ |
| Brechungsindex | 1.6000 (estimate) |
| Flammpunkt | 380 °C |
| Lagerbedingungen | 2-30°C |
| Löslichkeit | Soluble in dimethyl sulfoxide, acetone, chloroform, ethyl ether, n-hexane and benzene.decomposes |
| Aggregatzustand | Fine Powder |
| pKa (Säurekonstante) | 5.45[at 20 ℃] |
| Farbe | White to pale yellow |
| BRN | 213583 |
| Henry-Konstante | 1.3×103 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | 1S/C10H2O6/c11-7-3-1-4-6(10(14)16-8(4)12)2-5(3)9(13)15-7/h1-2H |
| InChIKey | ANSXAPJVJOKRDJ-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2cc3C(=O)OC(=O)c3cc12 |
| LogP (Verteilungskoeffizient) | -2.03 at 21.5℃ |
| CAS Datenbank | 89-32-7(CAS DataBase Reference) |
| NIST chemische Informationen | 1,2,4,5-Benzenetetracarboxylic anhydride(89-32-7) |
| EPA chemische Informationen | 1H,3H-Benzo[1,2-c:4,5-c']difuran-1,3,5,7-tetrone (89-32-7) |
Sicherheit & Vorschriften
| F | 10-21 |
|---|---|
| Wassergefährdungsklasse (WGK) | 1 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29173980 |
| RTECS-Nr. | DB9300000 |
| R-Sätze (R) | 41-42/43 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 22-24-26-37/39 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrstoffdaten | 89-32-7(Hazardous Substances Data) |
| Gefahrenklasse | Eye Dam. 1Resp. Sens. 1Skin Sens. 1 |
| Selbstentzündungstemperatur | 630°C |
Anwendungen & Verwendung
Verwenden
Pyromellitic dianhydride (PMDA) is employed as a curing agent for epoxy agent resins used for casting, laminating, the manufacture of moulding powders, adhesives and coatings.
Herstellung & Synthese
synthetische
Pyromellitic Dianhydride is prepared by gas-phase oxidation of 1,2,4,5-tetramethylbenzene (or related tetrasubstituted benzene derivatives). An idealized equation is:C6H2(CH3)4 + 6 O2 → C6H2(C2O3)2 + 6 H2OIn the laboratory, it can be prepared by dehydration of pyromellitic acid using acetic anhydride.