HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
trichlor-p-tolylsilan
DK370 · Tolyltrichlorosilane · p-Tolyltrichlorosilane · TRICHLORO-P-TOLYLSILANE · p-Tolylsilyl trichloride · 4-TRICHLOROSILYL TOLUENE · Silane, trichloro-p-tolyl- · p-Tolyltrichlorosilane,94%
Identifikatoren & physikalische Daten
| CAS No. | 701-35-9 |
|---|---|
| Summenformel | C7H7Cl3Si |
| Durchschnittliche Molmasse | 225,6 g/mol |
| Monoisotopische Masse | 223,93826 g/mol |
| SMILES | Cc1ccc([Si](Cl)(Cl)Cl)cc1 |
| InChIKey | WOMUGKOOLXQCTQ-UHFFFAOYSA-N |
| PubChem CID | 69697 |
| EC No. | 211-854-0 |
| DTXSID | DTXSID6061026 |
| Lokaler Name | trichlor-p-tolylsilan |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 0 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 124 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| Siedepunkt | 218-220 °C (lit.) |
| Dichte | 1.273 g/mL at 25 °C (lit.) |
| Dampfdruck | 0-4220000Pa at 20-25℃ |
| Brechungsindex | n20/D 1.5240(lit.) |
| Flammpunkt | 210 °F |
| Lagerbedingungen | Store at room temperature, keep dry and cool |
| Aggregatzustand | liquid |
| Wichte | 1.28 |
| Löslichkeit | Reacts with water. |
| BRN | 1866557 |
| InChI | 1S/C7H7Cl3Si/c1-6-2-4-7(5-3-6)11(8,9)10/h2-5H,1H3 |
| InChIKey | WOMUGKOOLXQCTQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)[Si](Cl)(Cl)Cl |
| LogP (Verteilungskoeffizient) | -0.6 |
| CAS Datenbank | 701-35-9(CAS DataBase Reference) |
| NIST chemische Informationen | 4-Tolyltrichlorosilane(701-35-9) |
| EPA chemische Informationen | Silane, trichloro(4-methylphenyl)- (701-35-9) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P264+P265, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | REACH registered substance: Trichloro-p-tolylsilane (EC: 211-854-0) |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 2987 8/PG 2 |
| Zollcode | 29319000 |
| R-Sätze (R) | 14-34 |
| Gefahrensymbole | C |
| Sicherheitshinweise (S) | 23-26-27-36/37/39-45 |
| Gefahrenklasse | 8Eye Dam. 1Skin Corr. 1B |
| Verpackungsgruppe | II |
| Lagerklasse | 8A - Combustible corrosive hazardous materials |
Anwendungen & Verwendung
Verwenden
It can be used to produce 3-(p-Methylphenyl)cyclohexanon.