HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 697365Erstellt: 4. November 2026
2-Morpholino-5-(3-methoxy-4-hydroxybenzylidene)-2-thiazoline-4-one
5-(4-hydroxy-3-methoxybenzylidene)-2-(4-morpholinyl)-1,3-thiazol-4(5H)-one
https://huagongshe.com/de/chemical/697365
Identifikatoren & physikalische Daten
| CAS No. | 101113-19-3 |
|---|
| Summenformel | C15H16N2O4S |
|---|
| Durchschnittliche Molmasse | 320,4 g/mol |
|---|
| Monoisotopische Masse | 320,08307817 g/mol |
|---|
| SMILES | COc1cc(/C=C2/SC(N3CCOCC3)=NC2=O)ccc1O |
|---|
| InChIKey | KUIFSWAFSKZRSU-UHFFFAOYSA-N |
|---|
| PubChem CID | 697365 |
|---|
| EC No. | 140-440-1 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,7 |
|---|
| Polarare Oberfläche (TPSA) | 96,7 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 5 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 22 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 488 |
|---|
| Siedepunkt | 508.366±60.00 °C(Press: 760.00 Torr)(predicted) |
|---|
| Dichte | 1.422±0.14 g/cm3(Temp: 25 °CPress: 760 Torr)(predicted) |
|---|
| pKa (Säurekonstante) | 9.190±0.35(predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]P264+P265, P280, P305+P351+P338, and P337+P317 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Eye Irrit. 2 (100%) |
|---|
