HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(1R)-1-(Naphthalen-1-yl)ethan-1-ol
−(R)-(+)-αCinacalcet Impurity 134 · (1R)-1-(1-naphthyl)ethan · (R)-(+)-1-Naphthalen-1-ol · (1R)-1-(1-naphthyl)ethanol · (1R)-1-naphthalen-1-ylethanol · (R)-(+)-1-(1-NAPHTHYL)ETHANOL · R-(-)-1-(1-Napthalenyl)ethanol · (R)-1-(naphthalen-1-yl)ethanol
Identifikatoren & physikalische Daten
| CAS No. | 42177-25-3 |
|---|---|
| Summenformel | C12H12O |
| Durchschnittliche Molmasse | 172,22 g/mol |
| Monoisotopische Masse | 172,088815 g/mol |
| SMILES | C[C@@H](O)c1cccc2ccccc12 |
| InChIKey | CDRQOYRPWJULJN-SECBINFHSA-N |
| PubChem CID | 6976567 |
| ChEMBL | CHEMBL378554 |
| DTXSID | DTXSID90426275 |
Chemische & physikalische Eigenschaften
| XLogP | 3 |
|---|---|
| Polarare Oberfläche (TPSA) | 20,2 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 167 |
| Schmelzpunkt | 47-49 °C(lit.) |
| Siedepunkt | 316.0±11.0 °C(Predicted) |
| Dichte | 1.113±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| pKa (Säurekonstante) | 14.29±0.20(Predicted) |
| InChI | InChI=1/C12H12O/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11/h2-9,13H,1H3/t9-/s3 |
| InChIKey | CDRQOYRPWJULJN-DJEYLCQNNA-N |
| SMILES | C12C=CC=CC=1C=CC=C2[C@H](O)C |&1:10,r| |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29062990 |
| Sicherheitshinweise (S) | 22-24/25 |
Anwendungen & Verwendung
Verwenden
(R)-1-(Naphthalen-1-yl)ethanol is a coupling reagent used in the synthesis of ferrocene aminophosphoxazoline ligands.