Identifikatoren & physikalische Daten
| CAS No. | 286440-05-9 |
|---|
| Summenformel | C14H11ClN2O3 |
|---|
| Durchschnittliche Molmasse | 290,7 g/mol |
|---|
| Monoisotopische Masse | 290,0458199 g/mol |
|---|
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1ccc(Cl)cc1 |
|---|
| InChIKey | REDLORXULQJGAK-UHFFFAOYSA-N |
|---|
| PubChem CID | 698255 |
|---|
| ChEMBL | CHEMBL1455697 |
|---|
| DTXSID | DTXSID401324293 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,5 |
|---|
| Polarare Oberfläche (TPSA) | 74,9 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 20 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 343 |
|---|
| Löslichkeit | 4.5 [ug/mL] (The mean of the results at pH 7.4) |
|---|
