HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Fluoren-2-ylmethylketon
2-Acetofluorene · 2-ACETYLFLUORENE · 2-Acetyl fluolene · 2-Acetylfluorene97% · 2-Acetyl-9H-fluorene · 2-Acetylfluorene 97% · 2-Acetylfluorene,98% · 2-Acetylfluorene >2-fluorenylmethylketone
Identifikatoren & physikalische Daten
| CAS No. | 781-73-7 |
|---|---|
| Summenformel | C15H12O |
| Durchschnittliche Molmasse | 208,25 g/mol |
| Monoisotopische Masse | 208,088815 g/mol |
| SMILES | CC(=O)c1ccc2c(c1)Cc1ccccc1-2 |
| InChIKey | IBASEVZORZFIIH-UHFFFAOYSA-N |
| PubChem CID | 69908 |
| ChEMBL | CHEMBL3188728 |
| EC No. | 212-310-5 |
| DTXSID | DTXSID6049357 |
| Lokaler Name | Fluoren-2-ylmethylketon |
Chemische & physikalische Eigenschaften
| XLogP | 3,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 17,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 16 |
| Formalladung | 0 |
| Komplexität | 283 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| Schmelzpunkt | 128-129 °C (lit.) |
| Siedepunkt | 307.46°C (rough estimate) |
| Dichte | 1.0459 (rough estimate) |
| Brechungsindex | 1.5361 (estimate) |
| Flammpunkt | 217 °C |
| Lagerbedingungen | Store at room temperature |
| Löslichkeit | soluble in Chloroform1 g/L (20 ºC) |
| Aggregatzustand | powder to crystal |
| Farbe | White to Light yellow |
| BRN | 1871711 |
| InChI | InChI=1S/C15H12O/c1-10(16)11-6-7-15-13(8-11)9-12-4-2-3-5-14(12)15/h2-8H,9H2,1H3 |
| InChIKey | IBASEVZORZFIIH-UHFFFAOYSA-N |
| SMILES | C(=O)(C1C=CC2C3=C(CC=2C=1)C=CC=C3)C |
| CAS Datenbank | 781-73-7(CAS DataBase Reference) |
| NIST chemische Informationen | 2-Acetylfluorene(781-73-7) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29143990 |
| RTECS-Nr. | OB3800000 |
| Sicherheitshinweise (S) | 24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Beschreibung
2-Acetylfluorene is a crystalline powder of light yellow and is stable under normal temperatures and pressures. 2-Acetylfluorene is incompatible with strong oxidising agents. 2-Acetylfluorene on decomposition releases carbon monoxide and carbon dioxide.