HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
9-Anthrylmethylketon
1-(anthracen-9-yl)ethan-1-one · Vitamin D2 Impurity 5 · 9-Acetylanthracene,95% · AURORA KA-7301 · 9-Acetylantracene · 9-Acetoanthracene · 9-Acetylanthracen · 9-Acetylanthracene
Identifikatoren & physikalische Daten
| CAS No. | 784-04-3 |
|---|---|
| Summenformel | C16H12O |
| Durchschnittliche Molmasse | 220,26 g/mol |
| Monoisotopische Masse | 220,088815 g/mol |
| SMILES | CC(=O)c1c2ccccc2cc2ccccc12 |
| InChIKey | NXXNVJDXUHMAHU-UHFFFAOYSA-N |
| PubChem CID | 69911 |
| EC No. | 212-315-2 |
| DTXSID | DTXSID90229061 |
| Lokaler Name | 9-Anthrylmethylketon |
Chemische & physikalische Eigenschaften
| XLogP | 4,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 17,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 17 |
| Formalladung | 0 |
| Komplexität | 274 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| LogP (Verteilungskoeffizient) | 3.6 |
| Schmelzpunkt | 75-76 °C (lit.) |
| Siedepunkt | 321.21°C (rough estimate) |
| Dichte | 1.0588 (rough estimate) |
| Brechungsindex | 1.5800 (estimate) |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | Chloroform (Slightly), Methanol (Slightly, Sonicated), Water (Slightly)Insoluble in water. |
| Aggregatzustand | Crystalline Powder |
| Farbe | Yellow to yellow-brown |
| BRN | 1370056 |
| InChI | InChI=1S/C16H12O/c1-11(17)16-14-8-4-2-6-12(14)10-13-7-3-5-9-15(13)16/h2-10H,1H3 |
| InChIKey | NXXNVJDXUHMAHU-UHFFFAOYSA-N |
| SMILES | C(=O)(C1C2=CC=CC=C2C=C2C=1C=CC=C2)C |
| CAS Datenbank | 784-04-3(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29143900 |
| Sicherheitshinweise (S) | 24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
9-Acetylanthracene is used in Organic Synthesis, Pharmaceuticals, Agrochemicals and Dyestuffs.