HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(S)-Enilconazole
(S)-Imazalil · (S)-enilconazole · Enilconazole Impurity 8 · 1H-Imidazole, 1-[(2S)-2-(2,4-dichlorophenyl)-2-(2-propen-1-yloxy)ethyl]-
Identifikatoren & physikalische Daten
| CAS No. | 166734-82-3 |
|---|---|
| Summenformel | C14H14Cl2N2O |
| Durchschnittliche Molmasse | 297,2 g/mol |
| Monoisotopische Masse | 296,0483185 g/mol |
| SMILES | C=CCO[C@H](Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChIKey | PZBPKYOVPCNPJY-CQSZACIVSA-N |
| PubChem CID | 6992070 |
| ChEBI | CHEBI:83830 |
| DTXSID | DTXSID601317866 |
Chemische & physikalische Eigenschaften
| XLogP | 3,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 27,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 19 |
| Formalladung | 0 |
| Komplexität | 291 |
| Siedepunkt | 448.5±45.0 °C(Predicted) |
| Dichte | 1.23±0.1 g/cm3(Predicted) |
| pKa (Säurekonstante) | 6.74±0.12(Predicted) |
Anwendungen & Verwendung
Verwenden
(S)-Imazalil is used as a fungicide for its enantioselective bioactivity, aquatic toxicity and dissipation in greenhouse vegetables and soil.