HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
S-Ethyl-L-homocystein
S-ethyl-L-homocysteine · H-ETH-OH · Nsc82393 · L-Ethionine · l-butyricaci · L-Ethionine>L-ETHIONINE 98+% · L -ETHIONINE 99% · s-ethyl-homocystein
Identifikatoren & physikalische Daten
| CAS No. | 13073-35-3 |
|---|---|
| Summenformel | C6H13NO2S |
| Durchschnittliche Molmasse | 163,24 g/mol |
| Monoisotopische Masse | 163,06669983 g/mol |
| SMILES | CCSCC[C@H]([NH3+])C(=O)[O-] |
| InChIKey | GGLZPLKKBSSKCX-YFKPBYRVSA-N |
| PubChem CID | 6992071 |
| Lokaler Name | S-Ethyl-L-homocystein |
Chemische & physikalische Eigenschaften
| XLogP | -1,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 93,1 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 102 |
| Schmelzpunkt | 280 °C (dec.)(lit.) |
| Dichte | 1.085 (estimate) |
| Brechungsindex | 22 ° (C=1, 1mol/L HCl) |
| Lagerbedingungen | Keep in dark place,Sealed in dry,2-8°C |
| Löslichkeit | Aqueous Acid (Slightly), Water (Slightly) |
| Aggregatzustand | solid |
| Siedepunkt | 310.4±37.0 °C(Predicted) |
| pKa (Säurekonstante) | 2.23±0.10(Predicted) |
| Farbe | White to Off-White |
| Merck | 14,3738 |
| InChI | 1S/C6H13NO2S/c1-2-10-4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | GGLZPLKKBSSKCX-YFKPBYRVSA-N |
| SMILES | CCSCC[C@H](N)C(O)=O |
| CAS Datenbank | 13073-35-3(CAS DataBase Reference) |
| EPA chemische Informationen | L-Ethionine (13073-35-3) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 2930.90.4950 |
| RTECS-Nr. | ES6825300 |
| R-Sätze (R) | 36/37/38 |
| Toxizität | rat,LD,intraperitoneal,> 1gm/kg (1000mg/kg),LIVER: OTHER CHANGESLIVER: CHANGES IN LIVER WEIGHT,Acta Pathologica Japonica. Vol. 39, Pg. 281, 1989. |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrstoffdaten | 13073-35-3(Hazardous Substances Data) |
| Gefahrenklasse | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
Anwendungen & Verwendung
Verwenden
Ethionine-induced inhibition of protein synthesis and lowering of ATP level in the liver.