HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(4-Fluorphenyl)hydrazin
AKOS BBS-00006439 · 4-Fluorophenylhydrazin · 4-Fluorophenylhydrazine · N-(4-Fluorophenyl)hydrazine · 1-(4-FLUOROPHENYL)HYDRAZINE · Hydrazine, (4-fluorophenyl)- · (4-Fluorophenyl)hydrazine - [F89850]
Identifikatoren & physikalische Daten
| CAS No. | 371-14-2 |
|---|---|
| Summenformel | C6H7FN2 |
| Durchschnittliche Molmasse | 126,13 g/mol |
| Monoisotopische Masse | 126,05932644 g/mol |
| SMILES | NNc1ccc(F)cc1 |
| InChIKey | ZXBMIRYQUFQQNX-UHFFFAOYSA-N |
| PubChem CID | 69982 |
| ChEMBL | CHEMBL3884307 |
| EC No. | 206-732-9 |
| DTXSID | DTXSID30190589 |
| Lokaler Name | (4-Fluorphenyl)hydrazin |
Chemische & physikalische Eigenschaften
| XLogP | 1,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 38,1 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 79,1 |
| SpringerMaterials Properties | 15N nuclear magnetic resonance spectrum |
| Schmelzpunkt | 36.8 °C |
| Siedepunkt | 227℃ |
| Dichte | 1.257 |
| Flammpunkt | 91℃ |
| Lagerbedingungen | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| pKa (Säurekonstante) | 5.24±0.20(Predicted) |
| InChI | InChI=1S/C6H7FN2/c7-5-1-3-6(9-8)4-2-5/h1-4,9H,8H2 |
| InChIKey | ZXBMIRYQUFQQNX-UHFFFAOYSA-N |
| SMILES | N(C1=CC=C(F)C=C1)N |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P330, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Alarmwort | Achtung |
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
Anwendungen & Verwendung
Verwenden
4-Fluorophenylhydrazine is a versatile reactant used in various syntheses such as domino synthesis of indoles by zinc-promoted hydrohydrazination of terminal alkynes.