HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Tris(4-methoxyphenyl)phosphin
tris(4-Methoxyphenyl)phosphane · TRIS(P-METHOXYPHENYL)PHOSPHINE · Trianisylphosphine · TRIS(P-METHOXYP · Tris(4-methoxyphenyL · Tri-p-anisylphosphine · LABOTEST-BB LTBB005439 · TRIS(P-ANISYL)PHOSPHINE
Identifikatoren & physikalische Daten
| CAS No. | 855-38-9 |
|---|---|
| Summenformel | C21H21O3P |
| Durchschnittliche Molmasse | 352,4 g/mol |
| Monoisotopische Masse | 352,12283116 g/mol |
| SMILES | COc1ccc(P(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChIKey | UYUUAUOYLFIRJG-UHFFFAOYSA-N |
| PubChem CID | 70071 |
| EC No. | 212-723-0 |
| DTXSID | DTXSID3061217 |
| Lokaler Name | Tris(4-methoxyphenyl)phosphin |
Chemische & physikalische Eigenschaften
| XLogP | 4,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 27,7 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 25 |
| Formalladung | 0 |
| Komplexität | 310 |
| SpringerMaterials Properties | Chemical shift |
| Schmelzpunkt | 131-134 °C (lit.) |
| Siedepunkt | 457.8±40.0 °C(Predicted) |
| Dichte | 1.1352 (estimate) |
| Lagerbedingungen | Inert atmosphere,Room Temperature |
| Aggregatzustand | Crystalline Powder |
| Farbe | White to pale yellow |
| Löslichkeit | Insoluble in water. |
| BRN | 2815911 |
| InChI | InChI=1S/C21H21O3P/c1-22-16-4-10-19(11-5-16)25(20-12-6-17(23-2)7-13-20)21-14-8-18(24-3)9-15-21/h4-15H,1-3H3 |
| InChIKey | UYUUAUOYLFIRJG-UHFFFAOYSA-N |
| SMILES | P(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=C(OC)C=C1 |
| CAS Datenbank | 855-38-9(CAS DataBase Reference) |
| EPA chemische Informationen | Phosphine, tris(4-methoxyphenyl)- (855-38-9) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29319090 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-37/39-24/25 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
Anwendungen & Verwendung
Verwenden
Tris(4-methoxyphenyl)phosphine is a useful intermediate employed in organic synthesis and in other chemical processes.