HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Brom-4-chloranilin
2-Bromo-4-chlorobenzenamine · 2-Bromo-4-chL · 2-Bromo-4-chlroaniline · 4-Chloro-2-Bromoanilin · 2-BROMO-4-CHLOROANILINE · 4-Chloro-2-Bromoaniline · 4-methoxy-2-bromo aniline · 2-Bromo-4-chloroaniline 99%
Identifikatoren & physikalische Daten
| CAS No. | 873-38-1 |
|---|---|
| Summenformel | C6H5BrClN |
| Durchschnittliche Molmasse | 206,47 g/mol |
| Monoisotopische Masse | 204,92938894 g/mol |
| SMILES | Nc1ccc(Cl)cc1Br |
| InChIKey | SYTBIFURTZACKR-UHFFFAOYSA-N |
| PubChem CID | 70110 |
| EC No. | 212-837-0 |
| DTXSID | DTXSID90236270 |
| Lokaler Name | 2-Brom-4-chloranilin |
Chemische & physikalische Eigenschaften
| XLogP | 3 |
|---|---|
| Polarare Oberfläche (TPSA) | 26 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 99,1 |
| Schmelzpunkt | 64-68 °C (lit.) |
| Siedepunkt | 127°C 14mm |
| Dichte | 1.722±0.06 g/cm3(Predicted) |
| Flammpunkt | 127°C/20mm |
| Lagerbedingungen | Keep in dark place,Inert atmosphere,Room temperature |
| Löslichkeit | soluble in Methanol |
| pKa (Säurekonstante) | 1.90±0.10(Predicted) |
| Aggregatzustand | Crystalline Powder |
| Farbe | Pale brown |
| BRN | 2802563 |
| InChI | InChI=1S/C6H5BrClN/c7-5-3-4(8)1-2-6(5)9/h1-3H,9H2 |
| InChIKey | SYTBIFURTZACKR-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Cl)C=C1Br |
| CAS Datenbank | 873-38-1(CAS DataBase Reference) |
| NIST chemische Informationen | 2-Bromo-4-chloroaniline(873-38-1) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (12.5%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P262, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P316, P317, P319, P321, P330, P332+P317, P337+P317, P361+P364, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (12.5%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN2811 |
| Zollcode | 29214200 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| hazard_note | Harmful |
| Sicherheitshinweise (S) | 26-36 |
| Gefahrenklasse | 6.1Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
2-Bromo-4-chloroaniline may be used in the preparation of:2-bromo-4-chloro-N-tosylaniline2-bromo-4-chlorothiophenol7-chloro-4a-methyl-4,4a,9,9a-tetrahydro-1H-carbazol-2(3H)-one