HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 70112Erstellt: 27. Oktober 2026
Cyclopropylbenzol
Cyclopropylbenzen · PHENYLCYCLOPROPANE · Cyclopropylbenzene · BENZENE,CYCLOPROPYL- · 1-Phenylcyclopropane · 1-CYCLOPROPYLBENZENE · Cyclopropane, phenyl-
https://huagongshe.com/de/chemical/70112
Identifikatoren & physikalische Daten
| CAS No. | 873-49-4 |
|---|
| Summenformel | C9H10 |
|---|
| Durchschnittliche Molmasse | 118,18 g/mol |
|---|
| Monoisotopische Masse | 118,07825032 g/mol |
|---|
| SMILES | c1ccc(C2CC2)cc1 |
|---|
| InChIKey | VFSFCYAQBIPUSL-UHFFFAOYSA-N |
|---|
| PubChem CID | 70112 |
|---|
| ChEMBL | CHEMBL27706 |
|---|
| EC No. | 212-839-1 |
|---|
| DTXSID | DTXSID2074297 |
|---|
| Lokaler Name | Cyclopropylbenzol |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,3 |
|---|
| Polarare Oberfläche (TPSA) | 0 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 0 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 9 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 86,2 |
|---|
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
|---|
| LogP (Verteilungskoeffizient) | 3.27 |
|---|
| Schmelzpunkt | -31°C |
|---|
| Siedepunkt | 173.6 °C/753 mmHg (lit.) |
|---|
| Dichte | 0.94 g/mL at 25 °C (lit.) |
|---|
| Brechungsindex | n20/D 1.533(lit.) |
|---|
| Flammpunkt | 111 °F |
|---|
| Lagerbedingungen | Sealed in dry,Room Temperature |
|---|
| Aggregatzustand | liquid |
|---|
| InChI | InChI=1S/C9H10/c1-2-4-8(5-3-1)9-6-7-9/h1-5,9H,6-7H2 |
|---|
| InChIKey | VFSFCYAQBIPUSL-UHFFFAOYSA-N |
|---|
| SMILES | C1(C2CC2)=CC=CC=C1 |
|---|
| CAS Datenbank | 873-49-4(CAS DataBase Reference) |
|---|
| NIST chemische Informationen | Benzene, cyclopropyl-(873-49-4) |
|---|
| EPA chemische Informationen | Cyclopropylbenzene (873-49-4) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P280, P303+P361+P353, P370+P378, P403+P235, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
|---|
| Wassergefährdungsklasse (WGK) | 3 |
|---|
| UN-Transportnummer | UN 3295 3/PG 3 |
|---|
| Zollcode | 2902190000 |
|---|
| R-Sätze (R) | 10 |
|---|
| Sicherheitshinweise (S) | 16 |
|---|
| Gefahrenklasse | 3.2Flam. Liq. 3 |
|---|
| Verpackungsgruppe | III |
|---|
| Lagerklasse | 3 - Flammable liquids |
|---|
