HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Ethyl 4-(1,3-dioxoisoindolin-2-YL)-3-oxobutanoate
Ethyl 4-phthaliMidoacetoacetate · 2H-Isoindole-2-butanoic acid, 1,3-dihydro-β,1,3-trioxo-, ethyl ester
Identifikatoren & physikalische Daten
| CAS No. | 13855-80-6 |
|---|---|
| Summenformel | C14H13NO5 |
| Durchschnittliche Molmasse | 275,26 g/mol |
| Monoisotopische Masse | 275,07937252 g/mol |
| SMILES | CCOC(=O)CC(=O)CN1C(=O)c2ccccc2C1=O |
| InChIKey | CWDUXGINCDZFAQ-UHFFFAOYSA-N |
| PubChem CID | 701239 |
| DTXSID | DTXSID90930145 |
Chemische & physikalische Eigenschaften
| XLogP | 1 |
|---|---|
| Polarare Oberfläche (TPSA) | 80,8 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 20 |
| Formalladung | 0 |
| Komplexität | 421 |
Anwendungen & Verwendung
Verwenden
4-Phthalimidoacetoacetic Acid Ethyl Ester is an intermediate in the synthesis of 5-Aminolevulinic Acid-3-13C Hydrochloride which is a naturally occurring amino acid; precursor of tetrapyrroles in the biosynthesis of chlorophyll and heme. Antineoplastic (photosensitizer).