HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 7016321Erstellt: 5. November 2026
(R)-(-)-1-(4-Fluorophenyl)Ethyl Isothiocyanate
(R)-(-)-1-(4-Fluorophenyl)ethyl isothiocyanate · Benzene, 1-fluoro-4-[(1R)-1-isothiocyanatoethyl]-
https://huagongshe.com/de/chemical/7016321
Identifikatoren & physikalische Daten
| CAS No. | 737000-82-7 |
|---|
| Summenformel | C9H8FNS |
|---|
| Durchschnittliche Molmasse | 181,23 g/mol |
|---|
| Monoisotopische Masse | 181,0361486 g/mol |
|---|
| SMILES | C[C@@H](N=C=S)c1ccc(F)cc1 |
|---|
| InChIKey | JXMBAXGHCKMDES-SSDOTTSWSA-N |
|---|
| PubChem CID | 7016321 |
|---|
| EC No. | 679-446-9 |
|---|
| DTXSID | DTXSID90426816 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,6 |
|---|
| Polarare Oberfläche (TPSA) | 44,5 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 12 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 181 |
|---|
| Siedepunkt | 109-110℃/0.6mm |
|---|
| Dichte | 1,163 g/cm3 |
|---|
| Brechungsindex | 1.5605 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P264, P270, P271, P280, P301+P317, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P330, P362+P364, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 4 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| UN-Transportnummer | 2810 |
|---|
| R-Sätze (R) | 20/21/22-36/37/38 |
|---|
| Sicherheitshinweise (S) | 26-36/37/39 |
|---|
| Gefahrenklasse | 6.1 |
|---|
| Verpackungsgruppe | III |
|---|
