HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Brommethylnaphthalin
2-(broMoMethyl)napthalene · 2-Naphtylmethyl bromide · 2-naphthylmethyl bromide · 2-BMN · 2-Bromomethyl naphth · naphthylmethyl bromide · BROMOMETHYLNAPTHALENE-2 · 2-(Bromomethyl)phthalene
Identifikatoren & physikalische Daten
| CAS No. | 939-26-4 |
|---|---|
| Summenformel | C11H9Br |
| Durchschnittliche Molmasse | 221,09 g/mol |
| Monoisotopische Masse | 219,98876239 g/mol |
| SMILES | BrCc1ccc2ccccc2c1 |
| InChIKey | RUHJZSZTSCSTCC-UHFFFAOYSA-N |
| PubChem CID | 70320 |
| EC No. | 213-359-5 |
| DTXSID | DTXSID10239864 |
| Lokaler Name | 2-Brommethylnaphthalin |
Chemische & physikalische Eigenschaften
| XLogP | 3,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 144 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| Schmelzpunkt | 51-54 °C(lit.) |
| Siedepunkt | 213 °C100 mm Hg(lit.) |
| Dichte | 1.3971 (rough estimate) |
| Brechungsindex | 1.6411 (estimate) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | Chloroform (Sparingly), Ethyl Acetate (Very Slightly)Soluble in water (reacts), and chloroform. |
| Aggregatzustand | Fine Crystalline Powder |
| Farbe | Slightly yellow to light beige |
| BRN | 636546 |
| InChI | InChI=1S/C11H9Br/c12-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7H,8H2 |
| InChIKey | RUHJZSZTSCSTCC-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC=C1CBr |
| CAS Datenbank | 939-26-4(CAS DataBase Reference) |
| NIST chemische Informationen | Naphthalene, 2-(bromomethyl)-(939-26-4) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P261, P264, P272, P280, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P333+P317, P362+P364, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 50 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | Naphthalene, 2-(bromomethyl)-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| F | 10-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 3261 8/PG 2 |
| Zollcode | 29033036 |
| R-Sätze (R) | 34-43-36/37/38-36 |
| Gefahrensymbole | C,Xi |
| hazard_note | Corrosive/Keep Cold |
| Sicherheitshinweise (S) | 26-28-36/37/39-45-37-27 |
| Gefahrenklasse | 8Skin Corr. 1BSkin Sens. 1 |
| Verpackungsgruppe | II |
| Lagerklasse | 8A - Combustible corrosive hazardous materials |
Anwendungen & Verwendung
Verwenden
2-(Bromomethyl)naphthalene (2-BMN) can be employed as a starting material in the synthesis of 2-(fluoromethyl)naphthalene , 2-naphthylmethyl azide , 2-naphthalenecarboxaldehyde , diselenide, bis(2-naphthalenylmethyl) , 1H-1,2,3-triazole, 4,4′-(1,4-phenylene)bis[1-(2-naphthalenylmethyl).