HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N-isopropyl-10H-phenothiazine-10-carboxamide
N-(propan-2-yl)-10H-phenothiazine-10-carboxamide · 10H-Phenothiazine-10-carboxamide, N-(1-methylethyl)-
Identifikatoren & physikalische Daten
| CAS No. | 81225-58-3 |
|---|---|
| Summenformel | C16H16N2OS |
| Durchschnittliche Molmasse | 284,4 g/mol |
| Monoisotopische Masse | 284,09833431 g/mol |
| SMILES | CC(C)NC(=O)N1c2ccccc2Sc2ccccc21 |
| InChIKey | DIHZRSIYRBANNR-UHFFFAOYSA-N |
| PubChem CID | 704259 |
| ChEMBL | CHEMBL592185 |
| DTXSID | DTXSID201321174 |
Chemische & physikalische Eigenschaften
| XLogP | 3,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 57,6 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 20 |
| Formalladung | 0 |
| Komplexität | 338 |
| Löslichkeit | 33.4 [ug/mL] (The mean of the results at pH 7.4) |