Identifikatoren & physikalische Daten
| CAS No. | 1011-73-0 |
|---|
| Summenformel | C6H3N2NaO5 |
|---|
| Durchschnittliche Molmasse | 206,09 g/mol |
|---|
| Monoisotopische Masse | 205,99396548 g/mol |
|---|
| SMILES | O=[N+]([O-])c1ccc([O-])c([N+](=O)[O-])c1.[Na+] |
|---|
| InChIKey | JMOHQJVXBQAVNW-UHFFFAOYSA-M |
|---|
| PubChem CID | 70533 |
|---|
| EC No. | 213-786-7 |
|---|
| DTXSID | DTXSID5020524 |
|---|
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 115 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 5 |
|---|
| Frei drehbare Bindungen | 0 |
|---|
| Schwere Atome | 14 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 220 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH203 (100%): (Deleted) Explosivefire, blast or projection hazard [Danger Explosives]P210, P230, P240, P250, P261, P262, P264, P270, P271, P280, P301+P316, P302+P352, P304+P340, P316, P321, P330, P361+P364, P370+P380, P372, P373, P401, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory.H203: (Deleted) Explosive |
|---|
| Hazard Classes and Categories | Expl. 1.3 (100%)Explosives - Division 1.3 |
|---|
