HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
5-Brom-2-pyridylamin
5-BROMOPYRIDIN-2-AMINE · 5-BROMOPHTHALIDE · 5-bromo-2-pyridylamine · 5-BROMO-2-AMINOPYRIDINE · 5-BROMO-PYRIDIN-2-YLAMINE · NSC 26282 · JACS-1072-97-5 · AKOS BBS-00004444
Identifikatoren & physikalische Daten
| CAS No. | 1072-97-5 |
|---|---|
| Summenformel | C5H5BrN2 |
| Durchschnittliche Molmasse | 173,01 g/mol |
| Monoisotopische Masse | 171,96361026 g/mol |
| SMILES | Nc1ccc(Br)cn1 |
| InChIKey | WGOLHUGPTDEKCF-UHFFFAOYSA-N |
| PubChem CID | 70622 |
| EC No. | 214-019-9 |
| DTXSID | DTXSID5022144 |
| Lokaler Name | 5-Brom-2-pyridylamin |
Chemische & physikalische Eigenschaften
| XLogP | 1,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 38,9 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 8 |
| Formalladung | 0 |
| Komplexität | 76,8 |
| Schmelzpunkt | 133-138 °C (lit.) |
| Siedepunkt | 230.9±20.0 °C(Predicted) |
| Dichte | 1.6065 (rough estimate) |
| Brechungsindex | 1.5182 (estimate) |
| Lagerbedingungen | Keep in dark place,Inert atmosphere,Room temperature |
| pKa (Säurekonstante) | 4.65±0.13(Predicted) |
| Aggregatzustand | Crystalline Powder |
| Farbe | White to beige |
| Löslichkeit | Soluble in methanol, chloroform, ethyl acetate. Slightly soluble in water. |
| BRN | 108737 |
| InChI | InChI=1S/C5H5BrN2/c6-4-1-2-5(7)8-3-4/h1-3H,(H2,7,8) |
| InChIKey | WGOLHUGPTDEKCF-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(Br)C=C1 |
| CAS Datenbank | 1072-97-5(CAS DataBase Reference) |
| EPA chemische Informationen | 2-Amino-5-bromopyridine (1072-97-5) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (86.4%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P316, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 81 reports by companies from 12 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (86.4%) |
| F | 10 |
| Wassergefährdungsklasse (WGK) | 2 |
| UN-Transportnummer | UN 2811 6.1/PG 3 |
| Zollcode | 29333999 |
| R-Sätze (R) | 22-36/37/38 |
| Gefahrensymbole | Xn,Xi |
| Sicherheitshinweise (S) | 26-36 |
| Gefahrenklasse | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
2-Amino-5-bromopyridine is used for the synthesis of polycyclic azaarenes.