HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,2,6,6-Tetramethylheptan-3,5-dion
TMHD · 2,2,6,6-TETRAMETHYLHEPTANE-3,5-DIONE · DIPIVALOYLMETHANE · 2,2,6,6-Tetramethyl heptanedione · 2,2,6,6-Tetramethyl-3,5-heptadione · 3,5-Heptanedione, 2,2,6,6-tetramethyl- · butan-1-ol,propan-2-ol,titanium · dpm-h
Identifikatoren & physikalische Daten
| CAS No. | 1118-71-4 |
|---|---|
| Summenformel | C11H20O2 |
| Durchschnittliche Molmasse | 184,27 g/mol |
| Monoisotopische Masse | 184,14632988 g/mol |
| SMILES | CC(C)(C)C(=O)CC(=O)C(C)(C)C |
| InChIKey | YRAJNWYBUCUFBD-UHFFFAOYSA-N |
| PubChem CID | 70700 |
| ChEMBL | CHEMBL3186481 |
| EC No. | 214-268-3 |
| DTXSID | DTXSID7049396 |
| Lokaler Name | 2,2,6,6-Tetramethylheptan-3,5-dion |
Chemische & physikalische Eigenschaften
| XLogP | 2,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 34,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 189 |
| Schmelzpunkt | >400 °C (decomp) |
| Siedepunkt | 72-73 °C/6 mmHg (lit.) |
| Dichte | 0.883 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.459(lit.) |
| Flammpunkt | 153 °F |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | Difficult to mix. |
| Aggregatzustand | Liquid |
| pKa (Säurekonstante) | 11.60±0.10(Predicted) |
| Wichte | 0.883 |
| Farbe | Clear colorless to slightly yellow |
| BRN | 1447269 |
| InChI | 1S/C11H20O2/c1-10(2,3)8(12)7-9(13)11(4,5)6/h7H2,1-6H3 |
| InChIKey | YRAJNWYBUCUFBD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CC(=O)C(C)(C)C |
| LogP (Verteilungskoeffizient) | 2.818 (est) |
| CAS Datenbank | 1118-71-4(CAS DataBase Reference) |
| EPA chemische Informationen | 3,5-Heptanedione, 2,2,6,6-tetramethyl- (1118-71-4) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 1993 / PGIII |
| Zollcode | 29141900 |
| R-Sätze (R) | 22-40-36/37/38 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 24/25-36-26-22 |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
2,2,6,6-tetramethyl-3,5-heptanedione was used in the synthesis of α-aryl-β-diketones1 and dicyanamidobenzene-bridge diruthenium complex.