HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3-Chlor-10H-phenothiazin
Cyamemazine Impurity 11 · 3-chloro-10H-phenothiazine · 10H-Phenothiazine, 3-chloro-
Identifikatoren & physikalische Daten
| CAS No. | 1207-99-4 |
|---|---|
| Summenformel | C12H8ClNS |
| Durchschnittliche Molmasse | 233,72 g/mol |
| Monoisotopische Masse | 233,0065981 g/mol |
| SMILES | Clc1ccc2c(c1)Sc1ccccc1N2 |
| InChIKey | DPUVPRWTWNQSOS-UHFFFAOYSA-N |
| PubChem CID | 71017 |
| EC No. | 214-898-9 |
| DTXSID | DTXSID4061624 |
| Lokaler Name | 3-Chlor-10H-phenothiazin |
Chemische & physikalische Eigenschaften
| XLogP | 4,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 37,3 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 236 |
| InChI | InChI=1S/C12H8ClNS/c13-8-5-6-10-12(7-8)15-11-4-2-1-3-9(11)14-10/h1-7,14H |
| InChIKey | DPUVPRWTWNQSOS-UHFFFAOYSA-N |
| SMILES | C1=C2C(SC3=C(N2)C=CC=C3)=CC(Cl)=C1 |
| EPA chemische Informationen | 10H-Phenothiazine, 3-chloro- (1207-99-4) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| TSCA-Inventar-Status | TSCA listed |
Anwendungen & Verwendung
Verwenden
3-Chloro-10H-phenothiazine is a derivative of Phenothiazine (P318040). Phonothiazine derivatives are used in dyes and pharmaceuticals, and as additives for lubricants and polymers.