Identifikatoren & physikalische Daten
| CAS No. | 13057-73-3 |
|---|
| Summenformel | C17H14O3 |
|---|
| Durchschnittliche Molmasse | 266,29 g/mol |
|---|
| Monoisotopische Masse | 266,0942943 g/mol |
|---|
| SMILES | CCOc1ccc2c(=O)c(-c3ccccc3)coc2c1 |
|---|
| InChIKey | MEIOIMGKPPMDKW-UHFFFAOYSA-N |
|---|
| PubChem CID | 710554 |
|---|
| EC No. | 650-828-7 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,5 |
|---|
| Polarare Oberfläche (TPSA) | 35,5 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 20 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 382 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
