HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N-[(Benzyloxy)carbonyl]-L-tyrosin
Z-L-TYROSINE · CBZ-L-TYR-OH · N-CARBOBENZOXY-L-TYROSINE · BENZYLOXYCARBONYL-L-TYROSINE · N-BENZYLOXYCARBONYL-L-TYROSINE · N-Benzyloxycarbonyl-L-tyrosine, 99%, may contain up to ca 10% water · Z-L-Tyr · Z-Tyr-OH
![Molekülstruktur von N-[(Benzyloxy)carbonyl]-L-tyrosin](/img/chemical/712438.png)
Identifikatoren & physikalische Daten
| CAS No. | 1164-16-5 |
|---|---|
| Summenformel | C17H17NO5 |
| Durchschnittliche Molmasse | 315,32 g/mol |
| Monoisotopische Masse | 315,11067264 g/mol |
| SMILES | O=C(N[C@@H](Cc1ccc(O)cc1)C(=O)O)OCc1ccccc1 |
| InChIKey | MCRMUCXATQAAMN-HNNXBMFYSA-N |
| PubChem CID | 712438 |
| ChEMBL | CHEMBL291833 |
| DTXSID | DTXSID301313627 |
| Lokaler Name | N-[(Benzyloxy)carbonyl]-L-tyrosin |
Chemische & physikalische Eigenschaften
| XLogP | 1,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 95,9 |
| H-Brücken-Donoren | 3 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 7 |
| Schwere Atome | 23 |
| Formalladung | 0 |
| Komplexität | 386 |
| Schmelzpunkt | 57-60 °C(lit.) |
| Siedepunkt | 454.88°C (rough estimate) |
| Dichte | 1.1781 (rough estimate) |
| Brechungsindex | 10.0 ° (C=1, AcOH) |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | Acetic Acid (Sparingly), DMSO (Slightly), Methanol (Sparingly)1.53g/L(25 ºC) |
| pKa (Säurekonstante) | 2.97±0.10(Predicted) |
| Aggregatzustand | Solid |
| Farbe | Off-White |
| BRN | 2169918 |
| Hauptanwendungen | peptide synthesis |
| InChI | 1S/C17H17NO5.H2O/c19-14-8-6-12(7-9-14)10-15(16(20)21)18-17(22)23-11-13-4-2-1-3-5-13/h1-9,15,19H,10-11H2,(H,18,22)(H,20,21)1H2/t15-/m0./s1 |
| InChIKey | BBPCQKGWAVVMSL-RSAXXLAASA-N |
| SMILES | O=C(N[C@H](C(O)=O)CC1=CC=C(O)C=C1)OCC2=CC=CC=C2 |
| CAS Datenbank | 1164-16-5(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29242990 |
| R-Sätze (R) | 20/21/22-36/37/38 |
| Gefahrensymbole | Xi,Xn |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 22-24/25-36-26-45-36/37/39 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
N-Cbz-L-tyrosine is an N-Cbz-protected form of L-Tyrosine (T899975). L-Tyrosine is an essential amino acid that exhibits in vitro antioxidant and antiradical activities. L-Tyrosine is used as a precursor to synthesize catecholamines (e.g. Norepinephrine HCl [N674500]) in human keratinocytes, and also for the synthesis of proteins and thyroid hormones.