HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Methyl 6-bromo-4-chloronicotinate
methyl 6-bromo-4-chloropyridine-3-carboxylate · methyl 6-chloronicotinate · Methyl 6-broMo-4-chloronicotinate · 3-Pyridinecarboxylic acid, 6-bromo-4-chloro-, methyl ester
Identifikatoren & physikalische Daten
| CAS No. | 1256789-73-7 |
|---|---|
| Summenformel | C7H5BrClNO2 |
| Durchschnittliche Molmasse | 250,48 g/mol |
| Monoisotopische Masse | 248,91922 g/mol |
| SMILES | COC(=O)c1cnc(Br)cc1Cl |
| InChIKey | ZEASAUSJELNJFI-UHFFFAOYSA-N |
| PubChem CID | 71299178 |
| DTXSID | DTXSID80744293 |
Chemische & physikalische Eigenschaften
| XLogP | 2,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 39,2 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 179 |
| Schmelzpunkt | 68 - 71°C |
| Siedepunkt | 301.9±37.0 °C(Predicted) |
| Dichte | 1.684±0.06 g/cm3(Predicted) |
| Lagerbedingungen | under inert gas (nitrogen or Argon) at 2-8°C |
| Löslichkeit | Chloroform (Slightly), DMSO (Slightly) |
| pKa (Säurekonstante) | -1.24±0.10(Predicted) |
| Aggregatzustand | Solid |
| Farbe | White to Off-White |
| InChI | InChI=1S/C7H5BrClNO2/c1-12-7(11)4-3-10-6(8)2-5(4)9/h2-3H,1H3 |
| InChIKey | ZEASAUSJELNJFI-UHFFFAOYSA-N |
| SMILES | C1=NC(Br)=CC(Cl)=C1C(OC)=O |
Sicherheit & Vorschriften
| Zollcode | 2933399990 |
|---|
Anwendungen & Verwendung
Verwenden
Methyl 6-Bromo-4-chloronicotinate can be used as TNFα and IRAK4 inhibitors.